C25H28O21 — CID 163673626
2-[9-(carboxymethyl)-3,9-dihydroxy-2,5,7,10-tetraoxo-1,6-dioxecan-3-yl]acetic acid;3-ethyl-3-hydroxyoxolane-2,5-dione;(1-hydroxy-3,5-dioxocyclohexyl) formate (PubChem CID 163673626) has the molecular formula C25H28O21 and a molecular weight of 664.48 g/mol. Its IUPAC name is 2-[9-(carboxymethyl)-3,9-dihydroxy-2,5,7,10-tetraoxo-1,6-dioxecan-3-yl]acetic acid;3-ethyl-3-hydroxyoxolane-2,5-dione;(1-hydroxy-3,5-dioxocyclohexyl) formate.
| Compound Name | 2-[9-(carboxymethyl)-3,9-dihydroxy-2,5,7,10-tetraoxo-1,6-dioxecan-3-yl]acetic acid;3-ethyl-3-hydroxyoxolane-2,5-dione;(1-hydroxy-3,5-dioxocyclohexyl) formate |
|---|---|
| PubChem CID | 163673626 |
| Molecular Formula | C25H28O21 |
| Molecular Weight | 664.48 g/mol |
| Exact Mass | 664.11 |
| IUPAC Name | 2-[9-(carboxymethyl)-3,9-dihydroxy-2,5,7,10-tetraoxo-1,6-dioxecan-3-yl]acetic acid;3-ethyl-3-hydroxyoxolane-2,5-dione;(1-hydroxy-3,5-dioxocyclohexyl) formate |
| SMILES | CCC1(O)CC(=O)OC1=O.O=C(O)CC1(O)CC(=O)OC(=O)CC(O)(CC(=O)O)C(=O)OC1=O.O=COC1(O)CC(=O)CC(=O)C1 |
| InChI | InChI=1S/C12H12O12.C7H8O5.C6H8O4/c13-5(14)1-11(21)3-7(17)23-8(18)4-12(22,2-6(15)16)10(20)24-9(11)19;8-4-12-7(11)2-5(9)1-6(10)3-7;1-2-6(9)3-4(7)10-5(6)8/h21-22H,1-4H2,(H,13,14)(H,15,16);4,11H,1-3H2;9H,2-3H2,1H3 |
| InChIKey | JESHXRXUPCMCNT-UHFFFAOYSA-N |
| XLogP | -3.90 |
| TPSA | 346.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.48 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|