C21H18N2O6S4 — CID 163673677
ethyl 12-cyano-5-(1-cyano-2-ethoxy-2-oxoethylidene)-2,8-dimethoxy-4,6,10,14-tetrathiatetracyclo[7.5.0.03,7.011,13]tetradeca-1,3(7),8-triene-12-carboxylate (PubChem CID 163673677) has the molecular formula C21H18N2O6S4 and a molecular weight of 522.65 g/mol. Its IUPAC name is ethyl 12-cyano-5-(1-cyano-2-ethoxy-2-oxoethylidene)-2,8-dimethoxy-4,6,10,14-tetrathiatetracyclo[7.5.0.03,7.011,13]tetradeca-1,3(7),8-triene-12-carboxylate.
| Compound Name | ethyl 12-cyano-5-(1-cyano-2-ethoxy-2-oxoethylidene)-2,8-dimethoxy-4,6,10,14-tetrathiatetracyclo[7.5.0.03,7.011,13]tetradeca-1,3(7),8-triene-12-carboxylate |
|---|---|
| PubChem CID | 163673677 |
| Molecular Formula | C21H18N2O6S4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.00 |
| IUPAC Name | ethyl 12-cyano-5-(1-cyano-2-ethoxy-2-oxoethylidene)-2,8-dimethoxy-4,6,10,14-tetrathiatetracyclo[7.5.0.03,7.011,13]tetradeca-1,3(7),8-triene-12-carboxylate |
| SMILES | CCOC(=O)C(C#N)=C1Sc2c(OC)c3c(c(OC)c2S1)SC1C(S3)C1(C#N)C(=O)OCC |
| InChI | InChI=1S/C21H18N2O6S4/c1-5-28-18(24)9(7-22)19-32-14-10(26-3)12-13(11(27-4)15(14)33-19)31-17-16(30-12)21(17,8-23)20(25)29-6-2/h16-17H,5-6H2,1-4H3/b19-9- |
| InChIKey | JETLAUCBCIJNRR-OCKHKDLRSA-N |
| XLogP | 4.22 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|