C9H14N4S — CID 163674256
1-(2,6,7-trimethylpyrazolo[1,5-b][1,2,4]triazol-7-yl)ethanethiol (PubChem CID 163674256) has the molecular formula C9H14N4S and a molecular weight of 210.31 g/mol. Its IUPAC name is 1-(2,6,7-trimethylpyrazolo[1,5-b][1,2,4]triazol-7-yl)ethanethiol.
| Compound Name | 1-(2,6,7-trimethylpyrazolo[1,5-b][1,2,4]triazol-7-yl)ethanethiol |
|---|---|
| PubChem CID | 163674256 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-(2,6,7-trimethylpyrazolo[1,5-b][1,2,4]triazol-7-yl)ethanethiol |
| SMILES | CC1=Nn2nc(C)nc2C1(C)C(C)S |
| InChI | InChI=1S/C9H14N4S/c1-5-9(4,6(2)14)8-10-7(3)12-13(8)11-5/h6,14H,1-4H3 |
| InChIKey | JFGPMOMJPGYNBP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|