C18H24N2O6S — CID 163674307
2-[3-[4-(3-aminophenyl)-1,3-thiazol-2-yl]propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163674307) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-[3-[4-(3-aminophenyl)-1,3-thiazol-2-yl]propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[3-[4-(3-aminophenyl)-1,3-thiazol-2-yl]propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163674307 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-[3-[4-(3-aminophenyl)-1,3-thiazol-2-yl]propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Nc1cccc(-c2csc(CCCOC3OC(CO)C(O)C(O)C3O)n2)c1 |
| InChI | InChI=1S/C18H24N2O6S/c19-11-4-1-3-10(7-11)12-9-27-14(20-12)5-2-6-25-18-17(24)16(23)15(22)13(8-21)26-18/h1,3-4,7,9,13,15-18,21-24H,2,5-6,8,19H2 |
| InChIKey | JFHLOMRSJIZRCZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 138.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|