C49H37N2O2+ — CID 163674728
[4-[3-(4-hydroxyphenyl)-5-[4-methyl-3-(9-phenylcarbazol-3-yl)-3,4-dihydrocarbazol-9-yl]phenyl]phenyl]oxidanium (PubChem CID 163674728) has the molecular formula C49H37N2O2+ and a molecular weight of 685.85 g/mol. Its IUPAC name is [4-[3-(4-hydroxyphenyl)-5-[4-methyl-3-(9-phenylcarbazol-3-yl)-3,4-dihydrocarbazol-9-yl]phenyl]phenyl]oxidanium.
| Compound Name | [4-[3-(4-hydroxyphenyl)-5-[4-methyl-3-(9-phenylcarbazol-3-yl)-3,4-dihydrocarbazol-9-yl]phenyl]phenyl]oxidanium |
|---|---|
| PubChem CID | 163674728 |
| Molecular Formula | C49H37N2O2+ |
| Molecular Weight | 685.85 g/mol |
| Exact Mass | 685.28 |
| IUPAC Name | [4-[3-(4-hydroxyphenyl)-5-[4-methyl-3-(9-phenylcarbazol-3-yl)-3,4-dihydrocarbazol-9-yl]phenyl]phenyl]oxidanium |
| SMILES | CC1c2c(n(-c3cc(-c4ccc(O)cc4)cc(-c4ccc([OH2+])cc4)c3)c3ccccc23)C=CC1c1ccc2c(c1)c1ccccc1n2-c1ccccc1 |
| InChI | InChI=1S/C49H36N2O2/c1-31-41(34-19-25-47-44(30-34)42-11-5-7-13-45(42)50(47)37-9-3-2-4-10-37)24-26-48-49(31)43-12-6-8-14-46(43)51(48)38-28-35(32-15-20-39(52)21-16-32)27-36(29-38)33-17-22-40(53)23-18-33/h2-31,41,52-53H,1H3/p+1 |
| InChIKey | JFQZYUCIAFBHJR-UHFFFAOYSA-O |
| XLogP | 12.12 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.85 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|