C17H19FO2 — CID 163675010
2-[2-(3-fluorophenyl)-2-tricyclo[3.3.1.03,7]nonanyl]acetic acid (PubChem CID 163675010) has the molecular formula C17H19FO2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-2-tricyclo[3.3.1.03,7]nonanyl]acetic acid.
| Compound Name | 2-[2-(3-fluorophenyl)-2-tricyclo[3.3.1.03,7]nonanyl]acetic acid |
|---|---|
| PubChem CID | 163675010 |
| Molecular Formula | C17H19FO2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-2-tricyclo[3.3.1.03,7]nonanyl]acetic acid |
| SMILES | O=C(O)CC1(c2cccc(F)c2)C2CC3CC(C2)C1C3 |
| InChI | InChI=1S/C17H19FO2/c18-14-3-1-2-12(8-14)17(9-16(19)20)13-5-10-4-11(7-13)15(17)6-10/h1-3,8,10-11,13,15H,4-7,9H2,(H,19,20) |
| InChIKey | JFWUDHBXZNYYMS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |