About 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene
4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 163675301) has the molecular formula C14H19I
and a molecular weight of 314.21 g/mol. Its IUPAC name is 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene.
Molecular Properties
| Compound Name | 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene |
| PubChem CID | 163675301 |
| Molecular Formula | C14H19I |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | CCc1cc(C)c2c(c1)CC2CCCI |
| InChI | InChI=1S/C14H19I/c1-3-11-7-10(2)14-12(5-4-6-15)9-13(14)8-11/h7-8,12H,3-6,9H2,1-2H3 |
| InChIKey | JGDURFBPHQFNMU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene?
The IUPAC name of 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene (CID 163675301) is 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene.
What is the SMILES notation for 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene?
The canonical SMILES for 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene is CCc1cc(C)c2c(c1)CC2CCCI.
What is the InChIKey of 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene?
The InChIKey is JGDURFBPHQFNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19I/c1-3-11-7-10(2)14-12(5-4-6-15)9-13(14)8-11/h7-8,12H,3-6,9H2,1-2H3.
What are the key properties of 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene?
4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene has a molecular weight of 314.21 g/mol, XLogP of 4.41, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-8-(3-iodopropyl)-2-methylbicyclo[4.2.0]octa-1(6),2,4-triene is sourced from PubChem (CID 163675301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).