C25H16IN3O9 — CID 163675442
(24-aminooxy-14-hydrazinyloxy-15,23-dihydroxy-5-methoxy-9,18,27-trioxaheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaen-6-yl) hypoiodite (PubChem CID 163675442) has the molecular formula C25H16IN3O9 and a molecular weight of 629.32 g/mol. Its IUPAC name is (24-aminooxy-14-hydrazinyloxy-15,23-dihydroxy-5-methoxy-9,18,27-trioxaheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaen-6-yl) hypoiodite.
| Compound Name | (24-aminooxy-14-hydrazinyloxy-15,23-dihydroxy-5-methoxy-9,18,27-trioxaheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaen-6-yl) hypoiodite |
|---|---|
| PubChem CID | 163675442 |
| Molecular Formula | C25H16IN3O9 |
| Molecular Weight | 629.32 g/mol |
| Exact Mass | 628.99 |
| IUPAC Name | (24-aminooxy-14-hydrazinyloxy-15,23-dihydroxy-5-methoxy-9,18,27-trioxaheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaen-6-yl) hypoiodite |
| SMILES | COc1cc2c(cc1OI)oc1c3c4cc(ONN)c(O)cc4oc3c3c4cc(O)c(ON)cc4oc3c21 |
| InChI | InChI=1S/C25H16IN3O9/c1-32-18-4-10-15(7-19(18)36-26)35-25-21-9-3-17(38-29-27)12(31)5-13(9)33-23(21)20-8-2-11(30)16(37-28)6-14(8)34-24(20)22(10)25/h2-7,29-31H,27-28H2,1H3 |
| InChIKey | NTPFUWOMJPIPAF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 180.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.32 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|