About 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine
2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine (PubChem CID 163675526) has the molecular formula C7H9Cl2N
and a molecular weight of 178.06 g/mol. Its IUPAC name is 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine |
| PubChem CID | 163675526 |
| Molecular Formula | C7H9Cl2N |
| Molecular Weight | 178.06 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine |
| SMILES | CC1=CC(Cl)=C(N)C(Cl)C1 |
| InChI | InChI=1S/C7H9Cl2N/c1-4-2-5(8)7(10)6(9)3-4/h2,6H,3,10H2,1H3 |
| InChIKey | JGIZNLWGNNTOGG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.06 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine?
The IUPAC name of 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine (CID 163675526) is 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine.
What is the SMILES notation for 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine?
The canonical SMILES for 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine is CC1=CC(Cl)=C(N)C(Cl)C1.
What is the InChIKey of 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine?
The InChIKey is JGIZNLWGNNTOGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9Cl2N/c1-4-2-5(8)7(10)6(9)3-4/h2,6H,3,10H2,1H3.
What are the key properties of 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine?
2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine has a molecular weight of 178.06 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-4-methylcyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 163675526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).