C18H25NO — CID 163676177
9-butyl-6-methyl-3,4,4b,5,8,8a-hexahydrocarbazole-3-carbaldehyde (PubChem CID 163676177) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 9-butyl-6-methyl-3,4,4b,5,8,8a-hexahydrocarbazole-3-carbaldehyde.
| Compound Name | 9-butyl-6-methyl-3,4,4b,5,8,8a-hexahydrocarbazole-3-carbaldehyde |
|---|---|
| PubChem CID | 163676177 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 9-butyl-6-methyl-3,4,4b,5,8,8a-hexahydrocarbazole-3-carbaldehyde |
| SMILES | CCCCN1C2=C(CC(C=O)C=C2)C2CC(C)=CCC21 |
| InChI | InChI=1S/C18H25NO/c1-3-4-9-19-17-7-5-13(2)10-15(17)16-11-14(12-20)6-8-18(16)19/h5-6,8,12,14-15,17H,3-4,7,9-11H2,1-2H3 |
| InChIKey | JGXGZZXFXUEAMN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|