About N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide
N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide (PubChem CID 163677187) has the molecular formula C16H33N5O2
and a molecular weight of 327.47 g/mol. Its IUPAC name is N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide |
| PubChem CID | 163677187 |
| Molecular Formula | C16H33N5O2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCN/C(N)=N/CCCCCCN(C)[C@H](C)C(C)=O |
| InChI | InChI=1S/C16H33N5O2/c1-13(14(2)22)21(4)12-8-6-5-7-9-19-16(17)20-11-10-18-15(3)23/h13H,5-12H2,1-4H3,(H,18,23)(H3,17,19,20)/t13-/m1/s1 |
| InChIKey | JHRJSUJVVZQMSX-CYBMUJFWSA-N |
| XLogP | 0.50 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide?
The IUPAC name of N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide (CID 163677187) is N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide.
What is the SMILES notation for N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide?
The canonical SMILES for N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide is CC(=O)NCCN/C(N)=N/CCCCCCN(C)[C@H](C)C(C)=O.
What is the InChIKey of N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide?
The InChIKey is JHRJSUJVVZQMSX-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H33N5O2/c1-13(14(2)22)21(4)12-8-6-5-7-9-19-16(17)20-11-10-18-15(3)23/h13H,5-12H2,1-4H3,(H,18,23)(H3,17,19,20)/t13-/m1/s1.
What are the key properties of N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide?
N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide has a molecular weight of 327.47 g/mol, XLogP of 0.50, 12 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[N'-[6-[methyl-[(2R)-3-oxobutan-2-yl]amino]hexyl]carbamimidoyl]amino]ethyl]acetamide is sourced from PubChem (CID 163677187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).