C15H14N5O+ — CID 163677394
[1,3-diamino-2-cyano-3-(6-phenoxy-3-pyridinyl)prop-2-enylidene]azanium (PubChem CID 163677394) has the molecular formula C15H14N5O+ and a molecular weight of 280.31 g/mol. Its IUPAC name is [1,3-diamino-2-cyano-3-(6-phenoxy-3-pyridinyl)prop-2-enylidene]azanium.
| Compound Name | [1,3-diamino-2-cyano-3-(6-phenoxy-3-pyridinyl)prop-2-enylidene]azanium |
|---|---|
| PubChem CID | 163677394 |
| Molecular Formula | C15H14N5O+ |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [1,3-diamino-2-cyano-3-(6-phenoxy-3-pyridinyl)prop-2-enylidene]azanium |
| SMILES | N#CC(C(N)=[NH2+])=C(N)c1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C15H13N5O/c16-8-12(15(18)19)14(17)10-6-7-13(20-9-10)21-11-4-2-1-3-5-11/h1-7,9H,17H2,(H3,18,19)/p+1 |
| InChIKey | OOXOZEBDZKGNIW-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 123.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|