C14H12Br2F2N2 — CID 163677896
1-(3,6-dibromo-2-pyridinyl)-2-(2,4-difluoro-7-bicyclo[4.1.0]hepta-2,4-dienyl)ethanamine (PubChem CID 163677896) has the molecular formula C14H12Br2F2N2 and a molecular weight of 406.07 g/mol. Its IUPAC name is 1-(3,6-dibromo-2-pyridinyl)-2-(2,4-difluoro-7-bicyclo[4.1.0]hepta-2,4-dienyl)ethanamine.
| Compound Name | 1-(3,6-dibromo-2-pyridinyl)-2-(2,4-difluoro-7-bicyclo[4.1.0]hepta-2,4-dienyl)ethanamine |
|---|---|
| PubChem CID | 163677896 |
| Molecular Formula | C14H12Br2F2N2 |
| Molecular Weight | 406.07 g/mol |
| Exact Mass | 403.93 |
| IUPAC Name | 1-(3,6-dibromo-2-pyridinyl)-2-(2,4-difluoro-7-bicyclo[4.1.0]hepta-2,4-dienyl)ethanamine |
| SMILES | NC(CC1C2C=C(F)C=C(F)C21)c1nc(Br)ccc1Br |
| InChI | InChI=1S/C14H12Br2F2N2/c15-9-1-2-12(16)20-14(9)11(19)5-8-7-3-6(17)4-10(18)13(7)8/h1-4,7-8,11,13H,5,19H2 |
| InChIKey | JIHNLAUEGSAZSP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.07 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|