C24H32O4 — CID 163677964
ethenyl 3-[(1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl)methyl]-4,5-dihydroxybenzoate (PubChem CID 163677964) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is ethenyl 3-[(1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl)methyl]-4,5-dihydroxybenzoate.
| Compound Name | ethenyl 3-[(1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl)methyl]-4,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 163677964 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | ethenyl 3-[(1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl)methyl]-4,5-dihydroxybenzoate |
| SMILES | C=COC(=O)c1cc(O)c(O)c(CC2(C)C(C)CCC3(C)C(C)=CCCC32)c1 |
| InChI | InChI=1S/C24H32O4/c1-6-28-22(27)17-12-18(21(26)19(25)13-17)14-24(5)16(3)10-11-23(4)15(2)8-7-9-20(23)24/h6,8,12-13,16,20,25-26H,1,7,9-11,14H2,2-5H3 |
| InChIKey | JIIXOKQOXFYICT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|