C24H21Al2I2N2- — CID 163678762
N-[4-[4-[bis(alumanyl)amino]phenyl]iodanuidylphenyl]-N-iodo-4-phenylaniline (PubChem CID 163678762) has the molecular formula C24H21Al2I2N2- and a molecular weight of 645.22 g/mol. Its IUPAC name is N-[4-[4-[bis(alumanyl)amino]phenyl]iodanuidylphenyl]-N-iodo-4-phenylaniline.
| Compound Name | N-[4-[4-[bis(alumanyl)amino]phenyl]iodanuidylphenyl]-N-iodo-4-phenylaniline |
|---|---|
| PubChem CID | 163678762 |
| Molecular Formula | C24H21Al2I2N2- |
| Molecular Weight | 645.22 g/mol |
| Exact Mass | 644.94 |
| IUPAC Name | N-[4-[4-[bis(alumanyl)amino]phenyl]iodanuidylphenyl]-N-iodo-4-phenylaniline |
| SMILES | [AlH2]N([AlH2])c1ccc([I-]c2ccc(N(I)c3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H17I2N2.2Al.4H/c25-28(23-14-6-19(7-15-23)18-4-2-1-3-5-18)24-16-10-21(11-17-24)26-20-8-12-22(27)13-9-20;;;;;;/h1-17H;;;;;;/q-1;;;;;; |
| InChIKey | PFFXSDOAXJNJSR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|