C25H29N7O2 — CID 163678918
3-[1-[5-acetyl-1-(oxolan-3-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,3-dihydroindol-5-yl]-2-amino-4-methyliminobut-2-enenitrile (PubChem CID 163678918) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 3-[1-[5-acetyl-1-(oxolan-3-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,3-dihydroindol-5-yl]-2-amino-4-methyliminobut-2-enenitrile.
| Compound Name | 3-[1-[5-acetyl-1-(oxolan-3-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,3-dihydroindol-5-yl]-2-amino-4-methyliminobut-2-enenitrile |
|---|---|
| PubChem CID | 163678918 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 3-[1-[5-acetyl-1-(oxolan-3-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]-2,3-dihydroindol-5-yl]-2-amino-4-methyliminobut-2-enenitrile |
| SMILES | C/N=C/C(=C(N)C#N)c1ccc2c(c1)CCN2c1nn(C2CCOC2)c2c1CN(C(C)=O)CC2 |
| InChI | InChI=1S/C25H29N7O2/c1-16(33)30-8-6-24-21(14-30)25(29-32(24)19-7-10-34-15-19)31-9-5-18-11-17(3-4-23(18)31)20(13-28-2)22(27)12-26/h3-4,11,13,19H,5-10,14-15,27H2,1-2H3/b22-20?,28-13+ |
| InChIKey | BVTNAYBGNSNLJG-OQVDSTBLSA-N |
| XLogP | 2.34 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|