C12H17F2N5 — CID 163679215
N'-[N'-(2,6-difluorocyclohexa-1,3-dien-1-yl)carbamimidoyl]pyrrolidine-1-carboximidamide (PubChem CID 163679215) has the molecular formula C12H17F2N5 and a molecular weight of 269.30 g/mol. Its IUPAC name is N'-[N'-(2,6-difluorocyclohexa-1,3-dien-1-yl)carbamimidoyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-[N'-(2,6-difluorocyclohexa-1,3-dien-1-yl)carbamimidoyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 163679215 |
| Molecular Formula | C12H17F2N5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N'-[N'-(2,6-difluorocyclohexa-1,3-dien-1-yl)carbamimidoyl]pyrrolidine-1-carboximidamide |
| SMILES | NC(=N/C(N)=N\C1=C(F)C=CCC1F)N1CCCC1 |
| InChI | InChI=1S/C12H17F2N5/c13-8-4-3-5-9(14)10(8)17-11(15)18-12(16)19-6-1-2-7-19/h3-4,9H,1-2,5-7H2,(H4,15,16,17,18) |
| InChIKey | JJJUMOMNJSTKKB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|