About 3-(2-propoxyethoxymethyl)heptane-1,7-diimine
3-(2-propoxyethoxymethyl)heptane-1,7-diimine (PubChem CID 163680088) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 3-(2-propoxyethoxymethyl)heptane-1,7-diimine.
Molecular Properties
| Compound Name | 3-(2-propoxyethoxymethyl)heptane-1,7-diimine |
| PubChem CID | 163680088 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 3-(2-propoxyethoxymethyl)heptane-1,7-diimine |
| SMILES | [H]/N=C/CCCC(C/C=N/[H])COCCOCCC |
| InChI | InChI=1S/C13H26N2O2/c1-2-9-16-10-11-17-12-13(6-8-15)5-3-4-7-14/h7-8,13-15H,2-6,9-12H2,1H3/b14-7+,15-8+ |
| InChIKey | JKCCPGBFSNOSCD-IROCBMIISA-N |
| XLogP | 2.91 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-propoxyethoxymethyl)heptane-1,7-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-propoxyethoxymethyl)heptane-1,7-diimine?
The IUPAC name of 3-(2-propoxyethoxymethyl)heptane-1,7-diimine (CID 163680088) is 3-(2-propoxyethoxymethyl)heptane-1,7-diimine.
What is the SMILES notation for 3-(2-propoxyethoxymethyl)heptane-1,7-diimine?
The canonical SMILES for 3-(2-propoxyethoxymethyl)heptane-1,7-diimine is [H]/N=C/CCCC(C/C=N/[H])COCCOCCC.
What is the InChIKey of 3-(2-propoxyethoxymethyl)heptane-1,7-diimine?
The InChIKey is JKCCPGBFSNOSCD-IROCBMIISA-N. The full InChI is InChI=1S/C13H26N2O2/c1-2-9-16-10-11-17-12-13(6-8-15)5-3-4-7-14/h7-8,13-15H,2-6,9-12H2,1H3/b14-7+,15-8+.
What are the key properties of 3-(2-propoxyethoxymethyl)heptane-1,7-diimine?
3-(2-propoxyethoxymethyl)heptane-1,7-diimine has a molecular weight of 242.36 g/mol, XLogP of 2.91, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-propoxyethoxymethyl)heptane-1,7-diimine is sourced from PubChem (CID 163680088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).