C11H16NO3S- — CID 163680306
3-[[(2Z,4E)-5-methylhepta-2,4,6-trienylidene]amino]propane-1-sulfonate (PubChem CID 163680306) has the molecular formula C11H16NO3S- and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-[[(2Z,4E)-5-methylhepta-2,4,6-trienylidene]amino]propane-1-sulfonate.
| Compound Name | 3-[[(2Z,4E)-5-methylhepta-2,4,6-trienylidene]amino]propane-1-sulfonate |
|---|---|
| PubChem CID | 163680306 |
| Molecular Formula | C11H16NO3S- |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-[[(2Z,4E)-5-methylhepta-2,4,6-trienylidene]amino]propane-1-sulfonate |
| SMILES | C=C/C(C)=C/C=C\C=N\CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H17NO3S/c1-3-11(2)7-4-5-8-12-9-6-10-16(13,14)15/h3-5,7-8H,1,6,9-10H2,2H3,(H,13,14,15)/p-1/b5-4-,11-7+,12-8+ |
| InChIKey | JKGSWRBBIRVWLY-INBWHNMNSA-M |
| XLogP | 1.68 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|