C15H21N5 — CID 163680897
13-butyl-1,4,9,12-tetrazatetracyclo[6.5.2.04,15.011,14]pentadeca-8(15),9,11(14),12-tetraen-10-amine (PubChem CID 163680897) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 13-butyl-1,4,9,12-tetrazatetracyclo[6.5.2.04,15.011,14]pentadeca-8(15),9,11(14),12-tetraen-10-amine.
| Compound Name | 13-butyl-1,4,9,12-tetrazatetracyclo[6.5.2.04,15.011,14]pentadeca-8(15),9,11(14),12-tetraen-10-amine |
|---|---|
| PubChem CID | 163680897 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 13-butyl-1,4,9,12-tetrazatetracyclo[6.5.2.04,15.011,14]pentadeca-8(15),9,11(14),12-tetraen-10-amine |
| SMILES | CCCCc1nc2c(N)nc3c4c2n1CCN4CCC3 |
| InChI | InChI=1S/C15H21N5/c1-2-3-6-11-18-12-14-13-10(17-15(12)16)5-4-7-19(13)8-9-20(11)14/h2-9H2,1H3,(H2,16,17) |
| InChIKey | JKSYVANWYNKQJH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |