About (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine
(4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine (PubChem CID 163681403) has the molecular formula C9H15F2N
and a molecular weight of 175.22 g/mol. Its IUPAC name is (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine.
Molecular Properties
| Compound Name | (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine |
| PubChem CID | 163681403 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine |
| SMILES | CC1CC12[C@@H](N)CCCC2(F)F |
| InChI | InChI=1S/C9H15F2N/c1-6-5-8(6)7(12)3-2-4-9(8,10)11/h6-7H,2-5,12H2,1H3/t6?,7-,8?/m0/s1 |
| InChIKey | JLDLQUITZCJECR-WTIBDHCWSA-N |
| XLogP | 2.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine?
The IUPAC name of (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine (CID 163681403) is (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine.
What is the SMILES notation for (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine?
The canonical SMILES for (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine is CC1CC12[C@@H](N)CCCC2(F)F.
What is the InChIKey of (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine?
The InChIKey is JLDLQUITZCJECR-WTIBDHCWSA-N. The full InChI is InChI=1S/C9H15F2N/c1-6-5-8(6)7(12)3-2-4-9(8,10)11/h6-7H,2-5,12H2,1H3/t6?,7-,8?/m0/s1.
What are the key properties of (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine?
(4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine has a molecular weight of 175.22 g/mol, XLogP of 2.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-8,8-difluoro-2-methylspiro[2.5]octan-4-amine is sourced from PubChem (CID 163681403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).