C19H13N3 — CID 163682260
5-amino-9-phenylcarbazole-2-carbonitrile (PubChem CID 163682260) has the molecular formula C19H13N3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-amino-9-phenylcarbazole-2-carbonitrile.
| Compound Name | 5-amino-9-phenylcarbazole-2-carbonitrile |
|---|---|
| PubChem CID | 163682260 |
| Molecular Formula | C19H13N3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 5-amino-9-phenylcarbazole-2-carbonitrile |
| SMILES | N#Cc1ccc2c3c(N)cccc3n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C19H13N3/c20-12-13-9-10-15-18(11-13)22(14-5-2-1-3-6-14)17-8-4-7-16(21)19(15)17/h1-11H,21H2 |
| InChIKey | JLUSPHCLFPTTHB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|