About CID 163683283
CID 163683283 (PubChem CID 163683283) has the molecular formula C14H10B2I2O4
and a molecular weight of 517.66 g/mol.
Molecular Properties
| Compound Name | CID 163683283 |
| PubChem CID | 163683283 |
| Molecular Formula | C14H10B2I2O4 |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.89 |
| IUPAC Name | — |
| SMILES | [B]C([B])(I)C(C)(I)C(=O)Oc1cccc2c(O)cc(O)cc12 |
| InChI | InChI=1S/C14H10B2I2O4/c1-13(17,14(15,16)18)12(21)22-11-4-2-3-8-9(11)5-7(19)6-10(8)20/h2-6,19-20H,1H3 |
| InChIKey | RRDOZBUMZXPKML-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze CID 163683283 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163683283?
The IUPAC name of CID 163683283 (CID 163683283) is not available.
What is the SMILES notation for CID 163683283?
The canonical SMILES for CID 163683283 is [B]C([B])(I)C(C)(I)C(=O)Oc1cccc2c(O)cc(O)cc12.
What is the InChIKey of CID 163683283?
The InChIKey is RRDOZBUMZXPKML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10B2I2O4/c1-13(17,14(15,16)18)12(21)22-11-4-2-3-8-9(11)5-7(19)6-10(8)20/h2-6,19-20H,1H3.
What are the key properties of CID 163683283?
CID 163683283 has a molecular weight of 517.66 g/mol, XLogP of 2.78, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163683283 is sourced from PubChem (CID 163683283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).