About tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate
tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate (PubChem CID 163683302) has the molecular formula C29H39N3O5
and a molecular weight of 509.65 g/mol. Its IUPAC name is tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate |
| PubChem CID | 163683302 |
| Molecular Formula | C29H39N3O5 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCN1CCOCC1.CC(C)(C)OC(=O)n1c(-c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C18H18N2O2.C11H21NO3/c1-18(2,3)22-17(21)20-15-12-8-7-11-14(15)19-16(20)13-9-5-4-6-10-13;1-11(2,3)10(13)15-9-6-12-4-7-14-8-5-12/h4-12H,1-3H3;4-9H2,1-3H3 |
| InChIKey | JMQQCEDOHBQQLI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate?
The IUPAC name of tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate (CID 163683302) is tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate.
What is the SMILES notation for tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate?
The canonical SMILES for tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OCCN1CCOCC1.CC(C)(C)OC(=O)n1c(-c2ccccc2)nc2ccccc21.
What is the InChIKey of tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate?
The InChIKey is JMQQCEDOHBQQLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2.C11H21NO3/c1-18(2,3)22-17(21)20-15-12-8-7-11-14(15)19-16(20)13-9-5-4-6-10-13;1-11(2,3)10(13)15-9-6-12-4-7-14-8-5-12/h4-12H,1-3H3;4-9H2,1-3H3.
What are the key properties of tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate?
tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate has a molecular weight of 509.65 g/mol, XLogP of 5.39, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-phenylbenzimidazole-1-carboxylate;2-morpholin-4-ylethyl 2,2-dimethylpropanoate is sourced from PubChem (CID 163683302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).