C26H29F2N3O3 — CID 163684070
5-(2,6-difluoro-4-hex-1-ynylphenyl)-3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole (PubChem CID 163684070) has the molecular formula C26H29F2N3O3 and a molecular weight of 469.53 g/mol. Its IUPAC name is 5-(2,6-difluoro-4-hex-1-ynylphenyl)-3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole.
| Compound Name | 5-(2,6-difluoro-4-hex-1-ynylphenyl)-3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 163684070 |
| Molecular Formula | C26H29F2N3O3 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 5-(2,6-difluoro-4-hex-1-ynylphenyl)-3-[[2-[(1S)-1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazole |
| SMILES | CCCCC#Cc1cc(F)c(-c2cc(Cn3ccnc3[C@H](C)OC3CCCCO3)no2)c(F)c1 |
| InChI | InChI=1S/C26H29F2N3O3/c1-3-4-5-6-9-19-14-21(27)25(22(28)15-19)23-16-20(30-34-23)17-31-12-11-29-26(31)18(2)33-24-10-7-8-13-32-24/h11-12,14-16,18,24H,3-5,7-8,10,13,17H2,1-2H3/t18-,24?/m0/s1 |
| InChIKey | BPKWNUGRCNZFAQ-VEXWJQHLSA-N |
| XLogP | 6.01 |
| TPSA | 62.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|