C24H36N2O5S — CID 163684542
(4R)-2-(1,1-diethoxyethyl)-4-methyl-N-[(1R)-1-(5-oxo-3-prop-2-enoxycyclohexa-1,3-dien-1-yl)butyl]-5H-1,3-thiazole-4-carboxamide (PubChem CID 163684542) has the molecular formula C24H36N2O5S and a molecular weight of 464.63 g/mol. Its IUPAC name is (4R)-2-(1,1-diethoxyethyl)-4-methyl-N-[(1R)-1-(5-oxo-3-prop-2-enoxycyclohexa-1,3-dien-1-yl)butyl]-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-2-(1,1-diethoxyethyl)-4-methyl-N-[(1R)-1-(5-oxo-3-prop-2-enoxycyclohexa-1,3-dien-1-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 163684542 |
| Molecular Formula | C24H36N2O5S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (4R)-2-(1,1-diethoxyethyl)-4-methyl-N-[(1R)-1-(5-oxo-3-prop-2-enoxycyclohexa-1,3-dien-1-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
| SMILES | C=CCOC1=CC(=O)CC([C@@H](CCC)NC(=O)[C@]2(C)CSC(C(C)(OCC)OCC)=N2)=C1 |
| InChI | InChI=1S/C24H36N2O5S/c1-7-11-20(17-13-18(27)15-19(14-17)29-12-8-2)25-21(28)23(5)16-32-22(26-23)24(6,30-9-3)31-10-4/h8,14-15,20H,2,7,9-13,16H2,1,3-6H3,(H,25,28)/t20-,23+/m1/s1 |
| InChIKey | JNRWYCCMWOPZRD-OFNKIYASSA-N |
| XLogP | 3.95 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|