About ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate
ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate (PubChem CID 163684566) has the molecular formula C10H14FNO2
and a molecular weight of 199.22 g/mol. Its IUPAC name is ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate |
| PubChem CID | 163684566 |
| Molecular Formula | C10H14FNO2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate |
| SMILES | CCOC(=O)NC1C=CC(F)=CC1C |
| InChI | InChI=1S/C10H14FNO2/c1-3-14-10(13)12-9-5-4-8(11)6-7(9)2/h4-7,9H,3H2,1-2H3,(H,12,13) |
| InChIKey | JNSLDCDOMIDFMS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate?
The IUPAC name of ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate (CID 163684566) is ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate.
What is the SMILES notation for ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate?
The canonical SMILES for ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate is CCOC(=O)NC1C=CC(F)=CC1C.
What is the InChIKey of ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate?
The InChIKey is JNSLDCDOMIDFMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FNO2/c1-3-14-10(13)12-9-5-4-8(11)6-7(9)2/h4-7,9H,3H2,1-2H3,(H,12,13).
What are the key properties of ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate?
ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate has a molecular weight of 199.22 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(4-fluoro-6-methylcyclohexa-2,4-dien-1-yl)carbamate is sourced from PubChem (CID 163684566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).