About 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium
2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium (PubChem CID 163684815) has the molecular formula C6H5BrF4N+
and a molecular weight of 247.01 g/mol. Its IUPAC name is 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium.
Molecular Properties
| Compound Name | 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium |
| PubChem CID | 163684815 |
| Molecular Formula | C6H5BrF4N+ |
| Molecular Weight | 247.01 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium |
| SMILES | FC1=C[NH2+]C(Br)C=C1C(F)(F)F |
| InChI | InChI=1S/C6H4BrF4N/c7-5-1-3(6(9,10)11)4(8)2-12-5/h1-2,5,12H/p+1 |
| InChIKey | JNYBDGIFOWPJEK-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.01 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium?
The IUPAC name of 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium (CID 163684815) is 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium.
What is the SMILES notation for 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium?
The canonical SMILES for 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium is FC1=C[NH2+]C(Br)C=C1C(F)(F)F.
What is the InChIKey of 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium?
The InChIKey is JNYBDGIFOWPJEK-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H4BrF4N/c7-5-1-3(6(9,10)11)4(8)2-12-5/h1-2,5,12H/p+1.
What are the key properties of 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium?
2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium has a molecular weight of 247.01 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-fluoro-4-(trifluoromethyl)-1,2-dihydropyridin-1-ium is sourced from PubChem (CID 163684815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).