About 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one
2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one (PubChem CID 163685112) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one.
Molecular Properties
| Compound Name | 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one |
| PubChem CID | 163685112 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one |
| SMILES | O=c1c2ccccc2ccn1[C@H]1CC[C@@H](CO)O1 |
| InChI | InChI=1S/C14H15NO3/c16-9-11-5-6-13(18-11)15-8-7-10-3-1-2-4-12(10)14(15)17/h1-4,7-8,11,13,16H,5-6,9H2/t11-,13+/m0/s1 |
| InChIKey | JOERFPWDOIYKSY-WCQYABFASA-N |
| XLogP | 1.67 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one?
The IUPAC name of 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one (CID 163685112) is 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one.
What is the SMILES notation for 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one?
The canonical SMILES for 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one is O=c1c2ccccc2ccn1[C@H]1CC[C@@H](CO)O1.
What is the InChIKey of 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one?
The InChIKey is JOERFPWDOIYKSY-WCQYABFASA-N. The full InChI is InChI=1S/C14H15NO3/c16-9-11-5-6-13(18-11)15-8-7-10-3-1-2-4-12(10)14(15)17/h1-4,7-8,11,13,16H,5-6,9H2/t11-,13+/m0/s1.
What are the key properties of 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one?
2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one has a molecular weight of 245.28 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]isoquinolin-1-one is sourced from PubChem (CID 163685112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).