About 3-pyran-2-yl-4H-1,2-oxazol-5-one
3-pyran-2-yl-4H-1,2-oxazol-5-one (PubChem CID 163685288) has the molecular formula C8H5NO3
and a molecular weight of 163.13 g/mol. Its IUPAC name is 3-pyran-2-yl-4H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-pyran-2-yl-4H-1,2-oxazol-5-one |
| PubChem CID | 163685288 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 3-pyran-2-yl-4H-1,2-oxazol-5-one |
| SMILES | O=C1CC(C2=CC=C=CO2)=NO1 |
| InChI | InChI=1S/C8H5NO3/c10-8-5-6(9-12-8)7-3-1-2-4-11-7/h1,3-4H,5H2 |
| InChIKey | JOIRIGFXZLSDKE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze 3-pyran-2-yl-4H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyran-2-yl-4H-1,2-oxazol-5-one?
The IUPAC name of 3-pyran-2-yl-4H-1,2-oxazol-5-one (CID 163685288) is 3-pyran-2-yl-4H-1,2-oxazol-5-one.
What is the SMILES notation for 3-pyran-2-yl-4H-1,2-oxazol-5-one?
The canonical SMILES for 3-pyran-2-yl-4H-1,2-oxazol-5-one is O=C1CC(C2=CC=C=CO2)=NO1.
What is the InChIKey of 3-pyran-2-yl-4H-1,2-oxazol-5-one?
The InChIKey is JOIRIGFXZLSDKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3/c10-8-5-6(9-12-8)7-3-1-2-4-11-7/h1,3-4H,5H2.
What are the key properties of 3-pyran-2-yl-4H-1,2-oxazol-5-one?
3-pyran-2-yl-4H-1,2-oxazol-5-one has a molecular weight of 163.13 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyran-2-yl-4H-1,2-oxazol-5-one is sourced from PubChem (CID 163685288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).