C10H16F2O2 — CID 163685509
(3E,5E)-3-ethyl-2,2-difluoroocta-3,5-diene-1,6-diol (PubChem CID 163685509) has the molecular formula C10H16F2O2 and a molecular weight of 206.23 g/mol. Its IUPAC name is (3E,5E)-3-ethyl-2,2-difluoroocta-3,5-diene-1,6-diol.
| Compound Name | (3E,5E)-3-ethyl-2,2-difluoroocta-3,5-diene-1,6-diol |
|---|---|
| PubChem CID | 163685509 |
| Molecular Formula | C10H16F2O2 |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (3E,5E)-3-ethyl-2,2-difluoroocta-3,5-diene-1,6-diol |
| SMILES | CC/C(O)=C\C=C(/CC)C(F)(F)CO |
| InChI | InChI=1S/C10H16F2O2/c1-3-8(10(11,12)7-13)5-6-9(14)4-2/h5-6,13-14H,3-4,7H2,1-2H3/b8-5+,9-6+ |
| InChIKey | JONGWHJCCJMDAM-XVYDYJIPSA-N |
| XLogP | 2.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|