C22H26FN7O3 — CID 163685518
2-[11-(azetidin-3-yl)-2,6-dioxo-5-propan-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-methyl-1H-pyridin-2-yl)acetamide (PubChem CID 163685518) has the molecular formula C22H26FN7O3 and a molecular weight of 455.49 g/mol. Its IUPAC name is 2-[11-(azetidin-3-yl)-2,6-dioxo-5-propan-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-methyl-1H-pyridin-2-yl)acetamide.
| Compound Name | 2-[11-(azetidin-3-yl)-2,6-dioxo-5-propan-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-methyl-1H-pyridin-2-yl)acetamide |
|---|---|
| PubChem CID | 163685518 |
| Molecular Formula | C22H26FN7O3 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-[11-(azetidin-3-yl)-2,6-dioxo-5-propan-2-yl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]-N-(5-fluoro-2-methyl-1H-pyridin-2-yl)acetamide |
| SMILES | CC(C)N1Cc2c(n(CC(=O)NC3(C)C=CC(F)=CN3)c3cc(C4CNC4)nn3c2=O)C1=O |
| InChI | InChI=1S/C22H26FN7O3/c1-12(2)28-10-15-19(21(28)33)29(11-17(31)26-22(3)5-4-14(23)9-25-22)18-6-16(13-7-24-8-13)27-30(18)20(15)32/h4-6,9,12-13,24-25H,7-8,10-11H2,1-3H3,(H,26,31) |
| InChIKey | JONLGBLJIDXQRF-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|