C12H23NO8 — CID 163686934
tert-butyl N-[(3S,6R)-4,5-dihydroxy-6-(hydroxymethoxy)-2-(hydroxymethyl)oxan-3-yl]carbamate (PubChem CID 163686934) has the molecular formula C12H23NO8 and a molecular weight of 309.32 g/mol. Its IUPAC name is tert-butyl N-[(3S,6R)-4,5-dihydroxy-6-(hydroxymethoxy)-2-(hydroxymethyl)oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,6R)-4,5-dihydroxy-6-(hydroxymethoxy)-2-(hydroxymethyl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 163686934 |
| Molecular Formula | C12H23NO8 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | tert-butyl N-[(3S,6R)-4,5-dihydroxy-6-(hydroxymethoxy)-2-(hydroxymethyl)oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C(CO)O[C@H](OCO)C(O)C1O |
| InChI | InChI=1S/C12H23NO8/c1-12(2,3)21-11(18)13-7-6(4-14)20-10(19-5-15)9(17)8(7)16/h6-10,14-17H,4-5H2,1-3H3,(H,13,18)/t6?,7-,8?,9?,10+/m1/s1 |
| InChIKey | JPQTVFBYMSAPFQ-LWWMSWIRSA-N |
| XLogP | -1.71 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|