About (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane
(5-chloro-2,5-dimethylhexan-2-yl)cyclobutane (PubChem CID 163687066) has the molecular formula C12H23Cl
and a molecular weight of 202.77 g/mol. Its IUPAC name is (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane.
Molecular Properties
| Compound Name | (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane |
| PubChem CID | 163687066 |
| Molecular Formula | C12H23Cl |
| Molecular Weight | 202.77 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane |
| SMILES | CC(C)(Cl)CCC(C)(C)C1CCC1 |
| InChI | InChI=1S/C12H23Cl/c1-11(2,10-6-5-7-10)8-9-12(3,4)13/h10H,5-9H2,1-4H3 |
| InChIKey | JPTNMEYIXHGOOY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane?
The IUPAC name of (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane (CID 163687066) is (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane.
What is the SMILES notation for (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane?
The canonical SMILES for (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane is CC(C)(Cl)CCC(C)(C)C1CCC1.
What is the InChIKey of (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane?
The InChIKey is JPTNMEYIXHGOOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23Cl/c1-11(2,10-6-5-7-10)8-9-12(3,4)13/h10H,5-9H2,1-4H3.
What are the key properties of (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane?
(5-chloro-2,5-dimethylhexan-2-yl)cyclobutane has a molecular weight of 202.77 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2,5-dimethylhexan-2-yl)cyclobutane is sourced from PubChem (CID 163687066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).