About CID 163687069
CID 163687069 (PubChem CID 163687069) has the molecular formula C11H11BFNO
and a molecular weight of 203.02 g/mol.
Molecular Properties
| Compound Name | CID 163687069 |
| PubChem CID | 163687069 |
| Molecular Formula | C11H11BFNO |
| Molecular Weight | 203.02 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | — |
| SMILES | [B]c1cc(/C(N)=C/OC(=C)C)ccc1F |
| InChI | InChI=1S/C11H11BFNO/c1-7(2)15-6-11(14)8-3-4-10(13)9(12)5-8/h3-6H,1,14H2,2H3/b11-6- |
| InChIKey | SUBHIXGSAGFWPC-WDZFZDKYSA-N |
| XLogP | 1.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.02 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163687069 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163687069?
The IUPAC name of CID 163687069 (CID 163687069) is not available.
What is the SMILES notation for CID 163687069?
The canonical SMILES for CID 163687069 is [B]c1cc(/C(N)=C/OC(=C)C)ccc1F.
What is the InChIKey of CID 163687069?
The InChIKey is SUBHIXGSAGFWPC-WDZFZDKYSA-N. The full InChI is InChI=1S/C11H11BFNO/c1-7(2)15-6-11(14)8-3-4-10(13)9(12)5-8/h3-6H,1,14H2,2H3/b11-6-.
What are the key properties of CID 163687069?
CID 163687069 has a molecular weight of 203.02 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163687069 is sourced from PubChem (CID 163687069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).