C22H25N3O2 — CID 163687713
4-(methoxymethyl)-2-N-[(6-methyl-3-phenylmethoxy-2-pyridinyl)methyl]benzene-1,2-diamine (PubChem CID 163687713) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-N-[(6-methyl-3-phenylmethoxy-2-pyridinyl)methyl]benzene-1,2-diamine.
| Compound Name | 4-(methoxymethyl)-2-N-[(6-methyl-3-phenylmethoxy-2-pyridinyl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 163687713 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 4-(methoxymethyl)-2-N-[(6-methyl-3-phenylmethoxy-2-pyridinyl)methyl]benzene-1,2-diamine |
| SMILES | COCc1ccc(N)c(NCc2nc(C)ccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-16-8-11-22(27-15-17-6-4-3-5-7-17)21(25-16)13-24-20-12-18(14-26-2)9-10-19(20)23/h3-12,24H,13-15,23H2,1-2H3 |
| InChIKey | JQHDMAUEOAIUKO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|