C21H24ClNO5 — CID 163688117
8-chloro-14-(dihydroxymethyl)-7-(3-methoxypropoxy)-3,3-dimethyl-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-5,7,9,11,14-pentaen-13-one (PubChem CID 163688117) has the molecular formula C21H24ClNO5 and a molecular weight of 405.88 g/mol. Its IUPAC name is 8-chloro-14-(dihydroxymethyl)-7-(3-methoxypropoxy)-3,3-dimethyl-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-5,7,9,11,14-pentaen-13-one.
| Compound Name | 8-chloro-14-(dihydroxymethyl)-7-(3-methoxypropoxy)-3,3-dimethyl-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-5,7,9,11,14-pentaen-13-one |
|---|---|
| PubChem CID | 163688117 |
| Molecular Formula | C21H24ClNO5 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 8-chloro-14-(dihydroxymethyl)-7-(3-methoxypropoxy)-3,3-dimethyl-1-azatetracyclo[9.4.0.02,4.05,10]pentadeca-5,7,9,11,14-pentaen-13-one |
| SMILES | COCCCOc1cc2c(cc1Cl)-c1cc(=O)c(C(O)O)cn1C1C2C1(C)C |
| InChI | InChI=1S/C21H24ClNO5/c1-21(2)18-12-8-17(28-6-4-5-27-3)14(22)7-11(12)15-9-16(24)13(20(25)26)10-23(15)19(18)21/h7-10,18-20,25-26H,4-6H2,1-3H3 |
| InChIKey | JQQLSLUDDNKSDP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|