About N-methyl-N-sulfinatoethanamine;vanadium;yttrium
N-methyl-N-sulfinatoethanamine;vanadium;yttrium (PubChem CID 163688761) has the molecular formula C3H7NO2SVY-2
and a molecular weight of 261.01 g/mol. Its IUPAC name is N-methyl-N-sulfinatoethanamine;vanadium;yttrium.
Molecular Properties
| Compound Name | N-methyl-N-sulfinatoethanamine;vanadium;yttrium |
| PubChem CID | 163688761 |
| Molecular Formula | C3H7NO2SVY-2 |
| Molecular Weight | 261.01 g/mol |
| Exact Mass | 260.87 |
| IUPAC Name | N-methyl-N-sulfinatoethanamine;vanadium;yttrium |
| SMILES | [CH2-]CN(C)[S-](=O)=O.[V].[Y] |
| InChI | InChI=1S/C3H7NO2S.V.Y/c1-3-4(2)7(5)6;;/h1,3H2,2H3;;/q-2;; |
| InChIKey | FMSHWSRJCUJPSL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.01 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-sulfinatoethanamine;vanadium;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-sulfinatoethanamine;vanadium;yttrium?
The IUPAC name of N-methyl-N-sulfinatoethanamine;vanadium;yttrium (CID 163688761) is N-methyl-N-sulfinatoethanamine;vanadium;yttrium.
What is the SMILES notation for N-methyl-N-sulfinatoethanamine;vanadium;yttrium?
The canonical SMILES for N-methyl-N-sulfinatoethanamine;vanadium;yttrium is [CH2-]CN(C)[S-](=O)=O.[V].[Y].
What is the InChIKey of N-methyl-N-sulfinatoethanamine;vanadium;yttrium?
The InChIKey is FMSHWSRJCUJPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2S.V.Y/c1-3-4(2)7(5)6;;/h1,3H2,2H3;;/q-2;;.
What are the key properties of N-methyl-N-sulfinatoethanamine;vanadium;yttrium?
N-methyl-N-sulfinatoethanamine;vanadium;yttrium has a molecular weight of 261.01 g/mol, XLogP of -0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-sulfinatoethanamine;vanadium;yttrium is sourced from PubChem (CID 163688761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).