About 2,4-difluoro-1-pentoxycyclohexa-1,3-diene
2,4-difluoro-1-pentoxycyclohexa-1,3-diene (PubChem CID 163689146) has the molecular formula C11H16F2O
and a molecular weight of 202.24 g/mol. Its IUPAC name is 2,4-difluoro-1-pentoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2,4-difluoro-1-pentoxycyclohexa-1,3-diene |
| PubChem CID | 163689146 |
| Molecular Formula | C11H16F2O |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2,4-difluoro-1-pentoxycyclohexa-1,3-diene |
| SMILES | CCCCCOC1=C(F)C=C(F)CC1 |
| InChI | InChI=1S/C11H16F2O/c1-2-3-4-7-14-11-6-5-9(12)8-10(11)13/h8H,2-7H2,1H3 |
| InChIKey | JRLNIPRSPLZNLQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,4-difluoro-1-pentoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-1-pentoxycyclohexa-1,3-diene?
The IUPAC name of 2,4-difluoro-1-pentoxycyclohexa-1,3-diene (CID 163689146) is 2,4-difluoro-1-pentoxycyclohexa-1,3-diene.
What is the SMILES notation for 2,4-difluoro-1-pentoxycyclohexa-1,3-diene?
The canonical SMILES for 2,4-difluoro-1-pentoxycyclohexa-1,3-diene is CCCCCOC1=C(F)C=C(F)CC1.
What is the InChIKey of 2,4-difluoro-1-pentoxycyclohexa-1,3-diene?
The InChIKey is JRLNIPRSPLZNLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2O/c1-2-3-4-7-14-11-6-5-9(12)8-10(11)13/h8H,2-7H2,1H3.
What are the key properties of 2,4-difluoro-1-pentoxycyclohexa-1,3-diene?
2,4-difluoro-1-pentoxycyclohexa-1,3-diene has a molecular weight of 202.24 g/mol, XLogP of 4.02, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-1-pentoxycyclohexa-1,3-diene is sourced from PubChem (CID 163689146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).