C8H11FN4O2 — CID 163689768
2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-2-methylpropanoic acid (PubChem CID 163689768) has the molecular formula C8H11FN4O2 and a molecular weight of 214.20 g/mol. Its IUPAC name is 2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-2-methylpropanoic acid.
| Compound Name | 2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 163689768 |
| Molecular Formula | C8H11FN4O2 |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-[(2-amino-5-fluoropyrimidin-4-yl)amino]-2-methylpropanoic acid |
| SMILES | CC(C)(Nc1nc(N)ncc1F)C(=O)O |
| InChI | InChI=1S/C8H11FN4O2/c1-8(2,6(14)15)13-5-4(9)3-11-7(10)12-5/h3H,1-2H3,(H,14,15)(H3,10,11,12,13) |
| InChIKey | JRZBQYLGGONDGE-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |