C34H42N4O6S — CID 163689774
tert-butyl (8R,12S)-21-cyclohexyl-17-(dimethylsulfamoylcarbamoyl)-5-methoxy-11,14-diazahexacyclo[12.7.0.02,7.08,12.010,12.015,20]henicosa-1(21),2(7),3,5,15(20),16,18-heptaene-11-carboxylate (PubChem CID 163689774) has the molecular formula C34H42N4O6S and a molecular weight of 634.80 g/mol. Its IUPAC name is tert-butyl (8R,12S)-21-cyclohexyl-17-(dimethylsulfamoylcarbamoyl)-5-methoxy-11,14-diazahexacyclo[12.7.0.02,7.08,12.010,12.015,20]henicosa-1(21),2(7),3,5,15(20),16,18-heptaene-11-carboxylate.
| Compound Name | tert-butyl (8R,12S)-21-cyclohexyl-17-(dimethylsulfamoylcarbamoyl)-5-methoxy-11,14-diazahexacyclo[12.7.0.02,7.08,12.010,12.015,20]henicosa-1(21),2(7),3,5,15(20),16,18-heptaene-11-carboxylate |
|---|---|
| PubChem CID | 163689774 |
| Molecular Formula | C34H42N4O6S |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | tert-butyl (8R,12S)-21-cyclohexyl-17-(dimethylsulfamoylcarbamoyl)-5-methoxy-11,14-diazahexacyclo[12.7.0.02,7.08,12.010,12.015,20]henicosa-1(21),2(7),3,5,15(20),16,18-heptaene-11-carboxylate |
| SMILES | COc1ccc2c(c1)[C@H]1CC3N(C(=O)OC(C)(C)C)[C@@]31Cn1c-2c(C2CCCCC2)c2ccc(C(=O)NS(=O)(=O)N(C)C)cc21 |
| InChI | InChI=1S/C34H42N4O6S/c1-33(2,3)44-32(40)38-28-18-26-25-17-22(43-6)13-15-23(25)30-29(20-10-8-7-9-11-20)24-14-12-21(31(39)35-45(41,42)36(4)5)16-27(24)37(30)19-34(26,28)38/h12-17,20,26,28H,7-11,18-19H2,1-6H3,(H,35,39)/t26-,28?,34-,38?/m1/s1 |
| InChIKey | JRZFAZWXZKHAQW-ZLECMREBSA-N |
| XLogP | 5.76 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|