C8H18N2 — CID 163690513
(E)-3-N-methylhept-5-ene-3,4-diamine (PubChem CID 163690513) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is (E)-3-N-methylhept-5-ene-3,4-diamine.
| Compound Name | (E)-3-N-methylhept-5-ene-3,4-diamine |
|---|---|
| PubChem CID | 163690513 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (E)-3-N-methylhept-5-ene-3,4-diamine |
| SMILES | C/C=C/C(N)C(CC)NC |
| InChI | InChI=1S/C8H18N2/c1-4-6-7(9)8(5-2)10-3/h4,6-8,10H,5,9H2,1-3H3/b6-4+ |
| InChIKey | JSOZEMAIUZDDEW-GQCTYLIASA-N |
| XLogP | 0.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|