About (E)-3-N-methylhept-5-ene-3,4-diamine
(E)-3-N-methylhept-5-ene-3,4-diamine (PubChem CID 163690513) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is (E)-3-N-methylhept-5-ene-3,4-diamine.
Molecular Properties
| Compound Name | (E)-3-N-methylhept-5-ene-3,4-diamine |
| PubChem CID | 163690513 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (E)-3-N-methylhept-5-ene-3,4-diamine |
| SMILES | C/C=C/C(N)C(CC)NC |
| InChI | InChI=1S/C8H18N2/c1-4-6-7(9)8(5-2)10-3/h4,6-8,10H,5,9H2,1-3H3/b6-4+ |
| InChIKey | JSOZEMAIUZDDEW-GQCTYLIASA-N |
| XLogP | 0.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-N-methylhept-5-ene-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-N-methylhept-5-ene-3,4-diamine?
The IUPAC name of (E)-3-N-methylhept-5-ene-3,4-diamine (CID 163690513) is (E)-3-N-methylhept-5-ene-3,4-diamine.
What is the SMILES notation for (E)-3-N-methylhept-5-ene-3,4-diamine?
The canonical SMILES for (E)-3-N-methylhept-5-ene-3,4-diamine is C/C=C/C(N)C(CC)NC.
What is the InChIKey of (E)-3-N-methylhept-5-ene-3,4-diamine?
The InChIKey is JSOZEMAIUZDDEW-GQCTYLIASA-N. The full InChI is InChI=1S/C8H18N2/c1-4-6-7(9)8(5-2)10-3/h4,6-8,10H,5,9H2,1-3H3/b6-4+.
What are the key properties of (E)-3-N-methylhept-5-ene-3,4-diamine?
(E)-3-N-methylhept-5-ene-3,4-diamine has a molecular weight of 142.25 g/mol, XLogP of 0.89, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-N-methylhept-5-ene-3,4-diamine is sourced from PubChem (CID 163690513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).