C8H11F6NO3S — CID 163691113
N-ethyl-2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)acetamide (PubChem CID 163691113) has the molecular formula C8H11F6NO3S and a molecular weight of 315.24 g/mol. Its IUPAC name is N-ethyl-2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)acetamide.
| Compound Name | N-ethyl-2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)acetamide |
|---|---|
| PubChem CID | 163691113 |
| Molecular Formula | C8H11F6NO3S |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-ethyl-2-(1,1,2,2,3,3-hexafluorobutylsulfonyl)acetamide |
| SMILES | CCNC(=O)CS(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C8H11F6NO3S/c1-3-15-5(16)4-19(17,18)8(13,14)7(11,12)6(2,9)10/h3-4H2,1-2H3,(H,15,16) |
| InChIKey | JCTNMNBYNGTFRE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|