About (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid
(E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid (PubChem CID 163691116) has the molecular formula C8H11AlN2O2
and a molecular weight of 194.17 g/mol. Its IUPAC name is (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid.
Molecular Properties
| Compound Name | (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid |
| PubChem CID | 163691116 |
| Molecular Formula | C8H11AlN2O2 |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid |
| SMILES | Cc1cc(/C=C(/[AlH2])C(=O)O)nn1C |
| InChI | InChI=1S/C8H9N2O2.Al.2H/c1-6-5-7(9-10(6)2)3-4-8(11)12;;;/h3,5H,1-2H3,(H,11,12);;; |
| InChIKey | JTALFBZJEVBHBS-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid?
The IUPAC name of (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid (CID 163691116) is (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid.
What is the SMILES notation for (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid?
The canonical SMILES for (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid is Cc1cc(/C=C(/[AlH2])C(=O)O)nn1C.
What is the InChIKey of (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid?
The InChIKey is JTALFBZJEVBHBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N2O2.Al.2H/c1-6-5-7(9-10(6)2)3-4-8(11)12;;;/h3,5H,1-2H3,(H,11,12);;;.
What are the key properties of (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid?
(E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid has a molecular weight of 194.17 g/mol, XLogP of -0.21, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-alumanyl-3-(1,5-dimethylpyrazol-3-yl)prop-2-enoic acid is sourced from PubChem (CID 163691116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).