About (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine
(3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine (PubChem CID 163691517) has the molecular formula C22H30N2O2
and a molecular weight of 354.49 g/mol. Its IUPAC name is (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine.
Molecular Properties
| Compound Name | (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine |
| PubChem CID | 163691517 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine |
| SMILES | CCON1CC[C@@H](N(Cc2ccccc2)Cc2ccccc2)[C@@H](OC)C1 |
| InChI | InChI=1S/C22H30N2O2/c1-3-26-24-15-14-21(22(18-24)25-2)23(16-19-10-6-4-7-11-19)17-20-12-8-5-9-13-20/h4-13,21-22H,3,14-18H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | JTIYWCWNTLAQQA-YADHBBJMSA-N |
| XLogP | 3.73 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine?
The IUPAC name of (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine (CID 163691517) is (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine.
What is the SMILES notation for (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine?
The canonical SMILES for (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine is CCON1CC[C@@H](N(Cc2ccccc2)Cc2ccccc2)[C@@H](OC)C1.
What is the InChIKey of (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine?
The InChIKey is JTIYWCWNTLAQQA-YADHBBJMSA-N. The full InChI is InChI=1S/C22H30N2O2/c1-3-26-24-15-14-21(22(18-24)25-2)23(16-19-10-6-4-7-11-19)17-20-12-8-5-9-13-20/h4-13,21-22H,3,14-18H2,1-2H3/t21-,22+/m1/s1.
What are the key properties of (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine?
(3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine has a molecular weight of 354.49 g/mol, XLogP of 3.73, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-N,N-dibenzyl-1-ethoxy-3-methoxypiperidin-4-amine is sourced from PubChem (CID 163691517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).