About CID 163691789
CID 163691789 (PubChem CID 163691789) has the molecular formula C7H5AlIN4S
and a molecular weight of 331.10 g/mol.
Molecular Properties
| Compound Name | CID 163691789 |
| PubChem CID | 163691789 |
| Molecular Formula | C7H5AlIN4S |
| Molecular Weight | 331.10 g/mol |
| Exact Mass | 330.91 |
| IUPAC Name | — |
| SMILES | I[Al]Nc1nccc(-c2nccs2)n1 |
| InChI | InChI=1S/C7H5N4S.Al.HI/c8-7-10-2-1-5(11-7)6-9-3-4-12-6;;/h1-4H,(H-,8,10,11);;1H/q-1;+2;/p-1 |
| InChIKey | PXRTUWWTGRXQLM-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.10 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 163691789 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163691789?
The IUPAC name of CID 163691789 (CID 163691789) is not available.
What is the SMILES notation for CID 163691789?
The canonical SMILES for CID 163691789 is I[Al]Nc1nccc(-c2nccs2)n1.
What is the InChIKey of CID 163691789?
The InChIKey is PXRTUWWTGRXQLM-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5N4S.Al.HI/c8-7-10-2-1-5(11-7)6-9-3-4-12-6;;/h1-4H,(H-,8,10,11);;1H/q-1;+2;/p-1.
What are the key properties of CID 163691789?
CID 163691789 has a molecular weight of 331.10 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163691789 is sourced from PubChem (CID 163691789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).