C21H20N4 — CID 163691822
(1Z,14Z,17Z)-16-methylidene-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1,4,6,8,10,12,14,17,19-nonaen-13-amine (PubChem CID 163691822) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is (1Z,14Z,17Z)-16-methylidene-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1,4,6,8,10,12,14,17,19-nonaen-13-amine.
| Compound Name | (1Z,14Z,17Z)-16-methylidene-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1,4,6,8,10,12,14,17,19-nonaen-13-amine |
|---|---|
| PubChem CID | 163691822 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1Z,14Z,17Z)-16-methylidene-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1,4,6,8,10,12,14,17,19-nonaen-13-amine |
| SMILES | C=C1/C=C\C(N)=Cc2ccc([nH]2)C=C2C=CC(/C=c3/cc/c([nH]3)=C/1)N2 |
| InChI | InChI=1S/C21H20N4/c1-14-2-3-15(22)11-17-5-7-19(24-17)13-21-9-8-20(25-21)12-18-6-4-16(10-14)23-18/h2-13,20,23-25H,1,22H2/b3-2-,15-11?,16-10-,18-12-,21-13? |
| InChIKey | JTPNGNDUQLQWAF-OLFWYUQXSA-N |
| XLogP | 1.90 |
| TPSA | 69.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |