C18H23BrN2OS — CID 163692464
(S)-N-[(2-amino-5-bromophenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide (PubChem CID 163692464) has the molecular formula C18H23BrN2OS and a molecular weight of 395.37 g/mol. Its IUPAC name is (S)-N-[(2-amino-5-bromophenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(2-amino-5-bromophenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 163692464 |
| Molecular Formula | C18H23BrN2OS |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (S)-N-[(2-amino-5-bromophenyl)-phenylmethyl]-N,2-dimethylpropane-2-sulfinamide |
| SMILES | CN(C(c1ccccc1)c1cc(Br)ccc1N)[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C18H23BrN2OS/c1-18(2,3)23(22)21(4)17(13-8-6-5-7-9-13)15-12-14(19)10-11-16(15)20/h5-12,17H,20H2,1-4H3/t17?,23-/m0/s1 |
| InChIKey | JUCZLAZPLFDCMQ-VXLWULRPSA-N |
| XLogP | 4.51 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|