About 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine
5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine (PubChem CID 163692751) has the molecular formula C19H31N3O2
and a molecular weight of 333.48 g/mol. Its IUPAC name is 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine.
Molecular Properties
| Compound Name | 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine |
| PubChem CID | 163692751 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine |
| SMILES | CC1CCC(C2CCC(OOc3cc(N)c(N)c(N)c3)CC2)CC1 |
| InChI | InChI=1S/C19H31N3O2/c1-12-2-4-13(5-3-12)14-6-8-15(9-7-14)23-24-16-10-17(20)19(22)18(21)11-16/h10-15H,2-9,20-22H2,1H3 |
| InChIKey | JUIXFKGTGISQQU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine?
The IUPAC name of 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine (CID 163692751) is 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine.
What is the SMILES notation for 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine?
The canonical SMILES for 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine is CC1CCC(C2CCC(OOc3cc(N)c(N)c(N)c3)CC2)CC1.
What is the InChIKey of 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine?
The InChIKey is JUIXFKGTGISQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N3O2/c1-12-2-4-13(5-3-12)14-6-8-15(9-7-14)23-24-16-10-17(20)19(22)18(21)11-16/h10-15H,2-9,20-22H2,1H3.
What are the key properties of 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine?
5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine has a molecular weight of 333.48 g/mol, XLogP of 4.13, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(4-methylcyclohexyl)cyclohexyl]peroxybenzene-1,2,3-triamine is sourced from PubChem (CID 163692751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).