C12H10F3N3O — CID 163693200
4,5-dimethyl-6-(2,4,6-trifluorophenoxy)pyrimidin-2-amine (PubChem CID 163693200) has the molecular formula C12H10F3N3O and a molecular weight of 269.23 g/mol. Its IUPAC name is 4,5-dimethyl-6-(2,4,6-trifluorophenoxy)pyrimidin-2-amine.
| Compound Name | 4,5-dimethyl-6-(2,4,6-trifluorophenoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163693200 |
| Molecular Formula | C12H10F3N3O |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4,5-dimethyl-6-(2,4,6-trifluorophenoxy)pyrimidin-2-amine |
| SMILES | Cc1nc(N)nc(Oc2c(F)cc(F)cc2F)c1C |
| InChI | InChI=1S/C12H10F3N3O/c1-5-6(2)17-12(16)18-11(5)19-10-8(14)3-7(13)4-9(10)15/h3-4H,1-2H3,(H2,16,17,18) |
| InChIKey | JUSVVMDTDNGNLI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |